C13H20N2O2S — CID 103485991
3-[2-[(2-methylcyclohexyl)amino]-1,3-thiazol-4-yl]propanoic acid (PubChem CID 103485991) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 3-[2-[(2-methylcyclohexyl)amino]-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-[(2-methylcyclohexyl)amino]-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 103485991 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3-[2-[(2-methylcyclohexyl)amino]-1,3-thiazol-4-yl]propanoic acid |
| SMILES | CC1CCCCC1Nc1nc(CCC(=O)O)cs1 |
| InChI | InChI=1S/C13H20N2O2S/c1-9-4-2-3-5-11(9)15-13-14-10(8-18-13)6-7-12(16)17/h8-9,11H,2-7H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | JTFIEYCSIRHNBP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |