C14H21N3O2S — CID 103488290
3-[2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 103488290) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 3-[2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 103488290 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 3-[2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)-1,3-thiazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1csc(NC2CCN3CCCC3C2)n1 |
| InChI | InChI=1S/C14H21N3O2S/c18-13(19)4-3-11-9-20-14(16-11)15-10-5-7-17-6-1-2-12(17)8-10/h9-10,12H,1-8H2,(H,15,16)(H,18,19) |
| InChIKey | QBDDRLGNSRRLPD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |