C14H22N2O3S — CID 103487674
3-[2-(2-cyclohexyloxyethylamino)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 103487674) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 3-[2-(2-cyclohexyloxyethylamino)-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-(2-cyclohexyloxyethylamino)-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 103487674 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3-[2-(2-cyclohexyloxyethylamino)-1,3-thiazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1csc(NCCOC2CCCCC2)n1 |
| InChI | InChI=1S/C14H22N2O3S/c17-13(18)7-6-11-10-20-14(16-11)15-8-9-19-12-4-2-1-3-5-12/h10,12H,1-9H2,(H,15,16)(H,17,18) |
| InChIKey | WCEASPPVNYRUPO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|