C12H20N2O2S — CID 103488722
3-[2-(2-ethylbutylamino)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 103488722) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 3-[2-(2-ethylbutylamino)-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-(2-ethylbutylamino)-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 103488722 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3-[2-(2-ethylbutylamino)-1,3-thiazol-4-yl]propanoic acid |
| SMILES | CCC(CC)CNc1nc(CCC(=O)O)cs1 |
| InChI | InChI=1S/C12H20N2O2S/c1-3-9(4-2)7-13-12-14-10(8-17-12)5-6-11(15)16/h8-9H,3-7H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | QYGPOMGZLAQWSL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |