C15H26N2O2S — CID 103488181
3-[2-(2,2-dimethylheptylamino)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 103488181) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 3-[2-(2,2-dimethylheptylamino)-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-(2,2-dimethylheptylamino)-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 103488181 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-[2-(2,2-dimethylheptylamino)-1,3-thiazol-4-yl]propanoic acid |
| SMILES | CCCCCC(C)(C)CNc1nc(CCC(=O)O)cs1 |
| InChI | InChI=1S/C15H26N2O2S/c1-4-5-6-9-15(2,3)11-16-14-17-12(10-20-14)7-8-13(18)19/h10H,4-9,11H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | VXZQUACKASWYGJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|