C14H24N2O2S — CID 114137997
3-[2-(octan-4-ylamino)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 114137997) has the molecular formula C14H24N2O2S and a molecular weight of 284.43 g/mol. Its IUPAC name is 3-[2-(octan-4-ylamino)-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-(octan-4-ylamino)-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 114137997 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 3-[2-(octan-4-ylamino)-1,3-thiazol-4-yl]propanoic acid |
| SMILES | CCCCC(CCC)Nc1nc(CCC(=O)O)cs1 |
| InChI | InChI=1S/C14H24N2O2S/c1-3-5-7-11(6-4-2)15-14-16-12(10-19-14)8-9-13(17)18/h10-11H,3-9H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | IBVXZGNIGNWLRW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |