C11H21N3S — CID 80704374
2-N-(4-ethyl-1,3-thiazol-2-yl)hexane-1,2-diamine (PubChem CID 80704374) has the molecular formula C11H21N3S and a molecular weight of 227.38 g/mol. Its IUPAC name is 2-N-(4-ethyl-1,3-thiazol-2-yl)hexane-1,2-diamine.
| Compound Name | 2-N-(4-ethyl-1,3-thiazol-2-yl)hexane-1,2-diamine |
|---|---|
| PubChem CID | 80704374 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2-N-(4-ethyl-1,3-thiazol-2-yl)hexane-1,2-diamine |
| SMILES | CCCCC(CN)Nc1nc(CC)cs1 |
| InChI | InChI=1S/C11H21N3S/c1-3-5-6-10(7-12)14-11-13-9(4-2)8-15-11/h8,10H,3-7,12H2,1-2H3,(H,13,14) |
| InChIKey | ZLFGBPPDKGKGMH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |