C19H27N3OS — CID 119664892
N-(1-aminohexan-2-yl)-2-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 119664892) has the molecular formula C19H27N3OS and a molecular weight of 345.51 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(1-aminohexan-2-yl)-2-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 119664892 |
| Molecular Formula | C19H27N3OS |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | CCCCC(CN)NC(=O)Cc1csc(-c2ccc(CC)cc2)n1 |
| InChI | InChI=1S/C19H27N3OS/c1-3-5-6-16(12-20)21-18(23)11-17-13-24-19(22-17)15-9-7-14(4-2)8-10-15/h7-10,13,16H,3-6,11-12,20H2,1-2H3,(H,21,23) |
| InChIKey | JMDPEAFCRBGRSO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |