C18H25N3OS — CID 119666140
N-(1-aminohexan-2-yl)-2-(2-benzyl-1,3-thiazol-4-yl)acetamide (PubChem CID 119666140) has the molecular formula C18H25N3OS and a molecular weight of 331.48 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-(2-benzyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(1-aminohexan-2-yl)-2-(2-benzyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 119666140 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-(2-benzyl-1,3-thiazol-4-yl)acetamide |
| SMILES | CCCCC(CN)NC(=O)Cc1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C18H25N3OS/c1-2-3-9-15(12-19)20-17(22)11-16-13-23-18(21-16)10-14-7-5-4-6-8-14/h4-8,13,15H,2-3,9-12,19H2,1H3,(H,20,22) |
| InChIKey | ATPCRLIXMKKUTA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |