C23H24N2O3S — CID 48588024
ethyl 3-[[2-(2-benzyl-1,3-thiazol-4-yl)acetyl]amino]-3-phenylpropanoate (PubChem CID 48588024) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is ethyl 3-[[2-(2-benzyl-1,3-thiazol-4-yl)acetyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl 3-[[2-(2-benzyl-1,3-thiazol-4-yl)acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 48588024 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | ethyl 3-[[2-(2-benzyl-1,3-thiazol-4-yl)acetyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)CC(NC(=O)Cc1csc(Cc2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O3S/c1-2-28-23(27)15-20(18-11-7-4-8-12-18)25-21(26)14-19-16-29-22(24-19)13-17-9-5-3-6-10-17/h3-12,16,20H,2,13-15H2,1H3,(H,25,26) |
| InChIKey | LZNJAFARWWQWIH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |