C20H25N3O3S — CID 126775870
3-[[2-(2-benzyl-1,3-thiazol-4-yl)acetyl]amino]-3-(oxan-4-yl)propanamide (PubChem CID 126775870) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is 3-[[2-(2-benzyl-1,3-thiazol-4-yl)acetyl]amino]-3-(oxan-4-yl)propanamide.
| Compound Name | 3-[[2-(2-benzyl-1,3-thiazol-4-yl)acetyl]amino]-3-(oxan-4-yl)propanamide |
|---|---|
| PubChem CID | 126775870 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 3-[[2-(2-benzyl-1,3-thiazol-4-yl)acetyl]amino]-3-(oxan-4-yl)propanamide |
| SMILES | NC(=O)CC(NC(=O)Cc1csc(Cc2ccccc2)n1)C1CCOCC1 |
| InChI | InChI=1S/C20H25N3O3S/c21-18(24)12-17(15-6-8-26-9-7-15)23-19(25)11-16-13-27-20(22-16)10-14-4-2-1-3-5-14/h1-5,13,15,17H,6-12H2,(H2,21,24)(H,23,25) |
| InChIKey | CYXMLKXCJCHGDT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |