C21H29N3OS — CID 119619930
2-(2-benzyl-1,3-thiazol-4-yl)-N-[2-(cycloheptylamino)ethyl]acetamide (PubChem CID 119619930) has the molecular formula C21H29N3OS and a molecular weight of 371.55 g/mol. Its IUPAC name is 2-(2-benzyl-1,3-thiazol-4-yl)-N-[2-(cycloheptylamino)ethyl]acetamide.
| Compound Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N-[2-(cycloheptylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 119619930 |
| Molecular Formula | C21H29N3OS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N-[2-(cycloheptylamino)ethyl]acetamide |
| SMILES | O=C(Cc1csc(Cc2ccccc2)n1)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C21H29N3OS/c25-20(23-13-12-22-18-10-6-1-2-7-11-18)15-19-16-26-21(24-19)14-17-8-4-3-5-9-17/h3-5,8-9,16,18,22H,1-2,6-7,10-15H2,(H,23,25) |
| InChIKey | PYLRZAKOEHRXRU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|