C21H22N2O2S — CID 95769499
2-(2-benzyl-1,3-thiazol-4-yl)-N-[(2R)-2-hydroxy-2-phenylpropyl]acetamide (PubChem CID 95769499) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-(2-benzyl-1,3-thiazol-4-yl)-N-[(2R)-2-hydroxy-2-phenylpropyl]acetamide.
| Compound Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N-[(2R)-2-hydroxy-2-phenylpropyl]acetamide |
|---|---|
| PubChem CID | 95769499 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N-[(2R)-2-hydroxy-2-phenylpropyl]acetamide |
| SMILES | C[C@](O)(CNC(=O)Cc1csc(Cc2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O2S/c1-21(25,17-10-6-3-7-11-17)15-22-19(24)13-18-14-26-20(23-18)12-16-8-4-2-5-9-16/h2-11,14,25H,12-13,15H2,1H3,(H,22,24)/t21-/m0/s1 |
| InChIKey | SSKYLIOSIIQISR-NRFANRHFSA-N |
| XLogP | 3.30 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |