C19H16F2N2OS — CID 86284851
N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-2-(3,5-difluorophenyl)acetamide (PubChem CID 86284851) has the molecular formula C19H16F2N2OS and a molecular weight of 358.41 g/mol. Its IUPAC name is N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-2-(3,5-difluorophenyl)acetamide.
| Compound Name | N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-2-(3,5-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 86284851 |
| Molecular Formula | C19H16F2N2OS |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-2-(3,5-difluorophenyl)acetamide |
| SMILES | O=C(Cc1cc(F)cc(F)c1)NCc1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C19H16F2N2OS/c20-15-6-14(7-16(21)10-15)8-18(24)22-11-17-12-25-19(23-17)9-13-4-2-1-3-5-13/h1-7,10,12H,8-9,11H2,(H,22,24) |
| InChIKey | ARJJUKPKURRNIX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |