C19H18N2O2S2 — CID 108737687
N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-4-oxo-4-thiophen-2-ylbutanamide (PubChem CID 108737687) has the molecular formula C19H18N2O2S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-4-oxo-4-thiophen-2-ylbutanamide.
| Compound Name | N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-4-oxo-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 108737687 |
| Molecular Formula | C19H18N2O2S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-4-oxo-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCC(=O)c1cccs1)NCc1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C19H18N2O2S2/c22-16(17-7-4-10-24-17)8-9-18(23)20-12-15-13-25-19(21-15)11-14-5-2-1-3-6-14/h1-7,10,13H,8-9,11-12H2,(H,20,23) |
| InChIKey | ZBCQMLYOXXBRGD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |