C20H25N3O2S — CID 131911007
N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-3-(2-oxoazepan-1-yl)propanamide (PubChem CID 131911007) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-3-(2-oxoazepan-1-yl)propanamide.
| Compound Name | N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-3-(2-oxoazepan-1-yl)propanamide |
|---|---|
| PubChem CID | 131911007 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-3-(2-oxoazepan-1-yl)propanamide |
| SMILES | O=C(CCN1CCCCCC1=O)NCc1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C20H25N3O2S/c24-18(10-12-23-11-6-2-5-9-20(23)25)21-14-17-15-26-19(22-17)13-16-7-3-1-4-8-16/h1,3-4,7-8,15H,2,5-6,9-14H2,(H,21,24) |
| InChIKey | XWKKEDDNAXGESK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |