C17H21N3O2S — CID 163305092
N-(1,3-benzothiazol-7-ylmethyl)-3-(2-oxoazepan-1-yl)propanamide (PubChem CID 163305092) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-(1,3-benzothiazol-7-ylmethyl)-3-(2-oxoazepan-1-yl)propanamide.
| Compound Name | N-(1,3-benzothiazol-7-ylmethyl)-3-(2-oxoazepan-1-yl)propanamide |
|---|---|
| PubChem CID | 163305092 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-(1,3-benzothiazol-7-ylmethyl)-3-(2-oxoazepan-1-yl)propanamide |
| SMILES | O=C(CCN1CCCCCC1=O)NCc1cccc2ncsc12 |
| InChI | InChI=1S/C17H21N3O2S/c21-15(8-10-20-9-3-1-2-7-16(20)22)18-11-13-5-4-6-14-17(13)23-12-19-14/h4-6,12H,1-3,7-11H2,(H,18,21) |
| InChIKey | YRFOJCUWZWHJJP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |