C11H15ClN2OS — CID 43138413
1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]azepan-2-one (PubChem CID 43138413) has the molecular formula C11H15ClN2OS and a molecular weight of 258.77 g/mol. Its IUPAC name is 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]azepan-2-one.
| Compound Name | 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]azepan-2-one |
|---|---|
| PubChem CID | 43138413 |
| Molecular Formula | C11H15ClN2OS |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]azepan-2-one |
| SMILES | O=C1CCCCCN1Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C11H15ClN2OS/c12-6-9-8-16-10(13-9)7-14-5-3-1-2-4-11(14)15/h8H,1-7H2 |
| InChIKey | BGVIKPVQNCIJOX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|