C8H11ClN2O2S2 — CID 43620084
2-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-1,2-thiazolidine 1,1-dioxide (PubChem CID 43620084) has the molecular formula C8H11ClN2O2S2 and a molecular weight of 266.77 g/mol. Its IUPAC name is 2-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-1,2-thiazolidine 1,1-dioxide.
| Compound Name | 2-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 43620084 |
| Molecular Formula | C8H11ClN2O2S2 |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | 2-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-1,2-thiazolidine 1,1-dioxide |
| SMILES | O=S1(=O)CCCN1Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C8H11ClN2O2S2/c9-4-7-6-14-8(10-7)5-11-2-1-3-15(11,12)13/h6H,1-5H2 |
| InChIKey | XGTWWVKDAXYWMK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|