C10H15ClN2OS — CID 61435144
1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]piperidin-3-ol (PubChem CID 61435144) has the molecular formula C10H15ClN2OS and a molecular weight of 246.76 g/mol. Its IUPAC name is 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]piperidin-3-ol.
| Compound Name | 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 61435144 |
| Molecular Formula | C10H15ClN2OS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]piperidin-3-ol |
| SMILES | OC1CCCN(Cc2nc(CCl)cs2)C1 |
| InChI | InChI=1S/C10H15ClN2OS/c11-4-8-7-15-10(12-8)6-13-3-1-2-9(14)5-13/h7,9,14H,1-6H2 |
| InChIKey | GDPZALDHIITEJR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|