C12H20N2OS — CID 51086523
1-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]piperidin-3-ol (PubChem CID 51086523) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is 1-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]piperidin-3-ol.
| Compound Name | 1-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 51086523 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]piperidin-3-ol |
| SMILES | CC(C)c1nc(CN2CCCC(O)C2)cs1 |
| InChI | InChI=1S/C12H20N2OS/c1-9(2)12-13-10(8-16-12)6-14-5-3-4-11(15)7-14/h8-9,11,15H,3-7H2,1-2H3 |
| InChIKey | MJXRFYYYFALTTB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |