C9H15N3OS — CID 130552808
1-[(2-amino-1,3-thiazol-4-yl)methyl]piperidin-3-ol (PubChem CID 130552808) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 1-[(2-amino-1,3-thiazol-4-yl)methyl]piperidin-3-ol.
| Compound Name | 1-[(2-amino-1,3-thiazol-4-yl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 130552808 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 1-[(2-amino-1,3-thiazol-4-yl)methyl]piperidin-3-ol |
| SMILES | Nc1nc(CN2CCCC(O)C2)cs1 |
| InChI | InChI=1S/C9H15N3OS/c10-9-11-7(6-14-9)4-12-3-1-2-8(13)5-12/h6,8,13H,1-5H2,(H2,10,11) |
| InChIKey | VDYOAAVCIWHJRQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |