C12H16N4OS — CID 62208261
1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-3-ol (PubChem CID 62208261) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-3-ol.
| Compound Name | 1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 62208261 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-3-ol |
| SMILES | Nc1nc(CN2CCCC(O)C2)nc2sccc12 |
| InChI | InChI=1S/C12H16N4OS/c13-11-9-3-5-18-12(9)15-10(14-11)7-16-4-1-2-8(17)6-16/h3,5,8,17H,1-2,4,6-7H2,(H2,13,14,15) |
| InChIKey | ZGIGGCUTBNPPPU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |