About 2-[1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-4-yl]acetamide
2-[1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-4-yl]acetamide (PubChem CID 62209002) has the molecular formula C14H19N5OS
and a molecular weight of 305.41 g/mol. Its IUPAC name is 2-[1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-4-yl]acetamide.
Molecular Properties
| Compound Name | 2-[1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-4-yl]acetamide |
| PubChem CID | 62209002 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-[1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-4-yl]acetamide |
| SMILES | NC(=O)CC1CCN(Cc2nc(N)c3ccsc3n2)CC1 |
| InChI | InChI=1S/C14H19N5OS/c15-11(20)7-9-1-4-19(5-2-9)8-12-17-13(16)10-3-6-21-14(10)18-12/h3,6,9H,1-2,4-5,7-8H2,(H2,15,20)(H2,16,17,18) |
| InChIKey | OHEYVAORPHRVPS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-4-yl]acetamide?
The IUPAC name of 2-[1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-4-yl]acetamide (CID 62209002) is 2-[1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-4-yl]acetamide.
What is the SMILES notation for 2-[1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-4-yl]acetamide?
The canonical SMILES for 2-[1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-4-yl]acetamide is NC(=O)CC1CCN(Cc2nc(N)c3ccsc3n2)CC1.
What is the InChIKey of 2-[1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-4-yl]acetamide?
The InChIKey is OHEYVAORPHRVPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5OS/c15-11(20)7-9-1-4-19(5-2-9)8-12-17-13(16)10-3-6-21-14(10)18-12/h3,6,9H,1-2,4-5,7-8H2,(H2,15,20)(H2,16,17,18).
What are the key properties of 2-[1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-4-yl]acetamide?
2-[1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-4-yl]acetamide has a molecular weight of 305.41 g/mol, XLogP of 1.36, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]piperidin-4-yl]acetamide is sourced from PubChem (CID 62209002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).