C12H18ClN3OS — CID 54989002
2-[1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl]acetamide (PubChem CID 54989002) has the molecular formula C12H18ClN3OS and a molecular weight of 287.82 g/mol. Its IUPAC name is 2-[1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl]acetamide.
| Compound Name | 2-[1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 54989002 |
| Molecular Formula | C12H18ClN3OS |
| Molecular Weight | 287.82 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-[1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl]acetamide |
| SMILES | NC(=O)CC1CCN(Cc2nc(CCl)cs2)CC1 |
| InChI | InChI=1S/C12H18ClN3OS/c13-6-10-8-18-12(15-10)7-16-3-1-9(2-4-16)5-11(14)17/h8-9H,1-7H2,(H2,14,17) |
| InChIKey | UGHZZLFTHPIZPO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.82 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|