C12H19ClN2OS — CID 43138386
[1-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]piperidin-4-yl]methanol (PubChem CID 43138386) has the molecular formula C12H19ClN2OS and a molecular weight of 274.82 g/mol. Its IUPAC name is [1-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]piperidin-4-yl]methanol.
| Compound Name | [1-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 43138386 |
| Molecular Formula | C12H19ClN2OS |
| Molecular Weight | 274.82 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | [1-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]piperidin-4-yl]methanol |
| SMILES | OCC1CCN(CCc2nc(CCl)cs2)CC1 |
| InChI | InChI=1S/C12H19ClN2OS/c13-7-11-9-17-12(14-11)3-6-15-4-1-10(8-16)2-5-15/h9-10,16H,1-8H2 |
| InChIKey | XVSDKAWROOAPFU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.82 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|