C11H17ClN2S2 — CID 43138391
4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]thiomorpholine (PubChem CID 43138391) has the molecular formula C11H17ClN2S2 and a molecular weight of 276.86 g/mol. Its IUPAC name is 4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]thiomorpholine.
| Compound Name | 4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]thiomorpholine |
|---|---|
| PubChem CID | 43138391 |
| Molecular Formula | C11H17ClN2S2 |
| Molecular Weight | 276.86 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]thiomorpholine |
| SMILES | ClCc1csc(CCCN2CCSCC2)n1 |
| InChI | InChI=1S/C11H17ClN2S2/c12-8-10-9-16-11(13-10)2-1-3-14-4-6-15-7-5-14/h9H,1-8H2 |
| InChIKey | GFGQCEQLYCCMLE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.86 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|