C15H25ClN2S2 — CID 107457594
4-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-7,7-dimethyl-1,4-thiazepane (PubChem CID 107457594) has the molecular formula C15H25ClN2S2 and a molecular weight of 332.97 g/mol. Its IUPAC name is 4-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-7,7-dimethyl-1,4-thiazepane.
| Compound Name | 4-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-7,7-dimethyl-1,4-thiazepane |
|---|---|
| PubChem CID | 107457594 |
| Molecular Formula | C15H25ClN2S2 |
| Molecular Weight | 332.97 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 4-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-7,7-dimethyl-1,4-thiazepane |
| SMILES | CC1(C)CCN(CCCCc2nc(CCl)cs2)CCS1 |
| InChI | InChI=1S/C15H25ClN2S2/c1-15(2)6-8-18(9-10-20-15)7-4-3-5-14-17-13(11-16)12-19-14/h12H,3-11H2,1-2H3 |
| InChIKey | OOKFLOFCVAWZNT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.97 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|