C16H28ClN3S — CID 62774435
2-[4-(4-butan-2-ylpiperazin-1-yl)butyl]-4-(chloromethyl)-1,3-thiazole (PubChem CID 62774435) has the molecular formula C16H28ClN3S and a molecular weight of 329.94 g/mol. Its IUPAC name is 2-[4-(4-butan-2-ylpiperazin-1-yl)butyl]-4-(chloromethyl)-1,3-thiazole.
| Compound Name | 2-[4-(4-butan-2-ylpiperazin-1-yl)butyl]-4-(chloromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 62774435 |
| Molecular Formula | C16H28ClN3S |
| Molecular Weight | 329.94 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-[4-(4-butan-2-ylpiperazin-1-yl)butyl]-4-(chloromethyl)-1,3-thiazole |
| SMILES | CCC(C)N1CCN(CCCCc2nc(CCl)cs2)CC1 |
| InChI | InChI=1S/C16H28ClN3S/c1-3-14(2)20-10-8-19(9-11-20)7-5-4-6-16-18-15(12-17)13-21-16/h13-14H,3-12H2,1-2H3 |
| InChIKey | VZRUDOAMRXKZLN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.94 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|