C15H26ClN3S — CID 81475586
1-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,N,4-trimethylpyrrolidin-3-amine (PubChem CID 81475586) has the molecular formula C15H26ClN3S and a molecular weight of 315.91 g/mol. Its IUPAC name is 1-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,N,4-trimethylpyrrolidin-3-amine.
| Compound Name | 1-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,N,4-trimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 81475586 |
| Molecular Formula | C15H26ClN3S |
| Molecular Weight | 315.91 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,N,4-trimethylpyrrolidin-3-amine |
| SMILES | CC1CN(CCCCc2nc(CCl)cs2)CC1N(C)C |
| InChI | InChI=1S/C15H26ClN3S/c1-12-9-19(10-14(12)18(2)3)7-5-4-6-15-17-13(8-16)11-20-15/h11-12,14H,4-10H2,1-3H3 |
| InChIKey | JNKGMROIZTWEPD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.91 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|