C16H27ClN2S — CID 63159007
4-(chloromethyl)-2-[3-(4,4-diethylpiperidin-1-yl)propyl]-1,3-thiazole (PubChem CID 63159007) has the molecular formula C16H27ClN2S and a molecular weight of 314.93 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[3-(4,4-diethylpiperidin-1-yl)propyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[3-(4,4-diethylpiperidin-1-yl)propyl]-1,3-thiazole |
|---|---|
| PubChem CID | 63159007 |
| Molecular Formula | C16H27ClN2S |
| Molecular Weight | 314.93 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 4-(chloromethyl)-2-[3-(4,4-diethylpiperidin-1-yl)propyl]-1,3-thiazole |
| SMILES | CCC1(CC)CCN(CCCc2nc(CCl)cs2)CC1 |
| InChI | InChI=1S/C16H27ClN2S/c1-3-16(4-2)7-10-19(11-8-16)9-5-6-15-18-14(12-17)13-20-15/h13H,3-12H2,1-2H3 |
| InChIKey | XWHHEDCCKVVILW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.93 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|