C14H22ClN3OS — CID 106320949
1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N,3-dimethylpyrrolidine-3-carboxamide (PubChem CID 106320949) has the molecular formula C14H22ClN3OS and a molecular weight of 315.87 g/mol. Its IUPAC name is 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N,3-dimethylpyrrolidine-3-carboxamide.
| Compound Name | 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N,3-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106320949 |
| Molecular Formula | C14H22ClN3OS |
| Molecular Weight | 315.87 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N,3-dimethylpyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1(C)CCN(CCCc2nc(CCl)cs2)C1 |
| InChI | InChI=1S/C14H22ClN3OS/c1-14(13(19)16-2)5-7-18(10-14)6-3-4-12-17-11(8-15)9-20-12/h9H,3-8,10H2,1-2H3,(H,16,19) |
| InChIKey | VZDCAKLXQQOPHQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.87 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|