C12H19ClN2OS — CID 43593130
4-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-2,2-dimethylmorpholine (PubChem CID 43593130) has the molecular formula C12H19ClN2OS and a molecular weight of 274.82 g/mol. Its IUPAC name is 4-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-2,2-dimethylmorpholine.
| Compound Name | 4-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 43593130 |
| Molecular Formula | C12H19ClN2OS |
| Molecular Weight | 274.82 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 4-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(CCc2nc(CCl)cs2)CCO1 |
| InChI | InChI=1S/C12H19ClN2OS/c1-12(2)9-15(5-6-16-12)4-3-11-14-10(7-13)8-17-11/h8H,3-7,9H2,1-2H3 |
| InChIKey | ZXQWTDDDVGRWAZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.82 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|