C14H22ClN3S — CID 79943191
2-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propyl]-4-(chloromethyl)-1,3-thiazole (PubChem CID 79943191) has the molecular formula C14H22ClN3S and a molecular weight of 299.87 g/mol. Its IUPAC name is 2-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propyl]-4-(chloromethyl)-1,3-thiazole.
| Compound Name | 2-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propyl]-4-(chloromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 79943191 |
| Molecular Formula | C14H22ClN3S |
| Molecular Weight | 299.87 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propyl]-4-(chloromethyl)-1,3-thiazole |
| SMILES | ClCc1csc(CCCN2CCN3CCCC3C2)n1 |
| InChI | InChI=1S/C14H22ClN3S/c15-9-12-11-19-14(16-12)4-2-5-17-7-8-18-6-1-3-13(18)10-17/h11,13H,1-10H2 |
| InChIKey | IUAJBLOKLITZAW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.87 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|