C12H18ClN3OS2 — CID 106326607
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2-thiomorpholin-4-ylethyl)acetamide (PubChem CID 106326607) has the molecular formula C12H18ClN3OS2 and a molecular weight of 319.88 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2-thiomorpholin-4-ylethyl)acetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2-thiomorpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 106326607 |
| Molecular Formula | C12H18ClN3OS2 |
| Molecular Weight | 319.88 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2-thiomorpholin-4-ylethyl)acetamide |
| SMILES | O=C(Cc1nc(CCl)cs1)NCCN1CCSCC1 |
| InChI | InChI=1S/C12H18ClN3OS2/c13-8-10-9-19-12(15-10)7-11(17)14-1-2-16-3-5-18-6-4-16/h9H,1-8H2,(H,14,17) |
| InChIKey | AGEVMDZFZHXEBQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.88 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|