C13H22Cl2N4OS — CID 120643105
2-(5-amino-2-pyridinyl)-N-(2-thiomorpholin-4-ylethyl)acetamide;dihydrochloride (PubChem CID 120643105) has the molecular formula C13H22Cl2N4OS and a molecular weight of 353.32 g/mol. Its IUPAC name is 2-(5-amino-2-pyridinyl)-N-(2-thiomorpholin-4-ylethyl)acetamide;dihydrochloride.
| Compound Name | 2-(5-amino-2-pyridinyl)-N-(2-thiomorpholin-4-ylethyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120643105 |
| Molecular Formula | C13H22Cl2N4OS |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-(5-amino-2-pyridinyl)-N-(2-thiomorpholin-4-ylethyl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(CC(=O)NCCN2CCSCC2)nc1 |
| InChI | InChI=1S/C13H20N4OS.2ClH/c14-11-1-2-12(16-10-11)9-13(18)15-3-4-17-5-7-19-8-6-17;;/h1-2,10H,3-9,14H2,(H,15,18);2*1H |
| InChIKey | FNBMHLDGORWAQC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |