C13H20Cl3N3OS — CID 119853632
4-amino-2-chloro-N-(2-thiomorpholin-4-ylethyl)benzamide;dihydrochloride (PubChem CID 119853632) has the molecular formula C13H20Cl3N3OS and a molecular weight of 372.75 g/mol. Its IUPAC name is 4-amino-2-chloro-N-(2-thiomorpholin-4-ylethyl)benzamide;dihydrochloride.
| Compound Name | 4-amino-2-chloro-N-(2-thiomorpholin-4-ylethyl)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119853632 |
| Molecular Formula | C13H20Cl3N3OS |
| Molecular Weight | 372.75 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 4-amino-2-chloro-N-(2-thiomorpholin-4-ylethyl)benzamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(C(=O)NCCN2CCSCC2)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClN3OS.2ClH/c14-12-9-10(15)1-2-11(12)13(18)16-3-4-17-5-7-19-8-6-17;;/h1-2,9H,3-8,15H2,(H,16,18);2*1H |
| InChIKey | AEEIHQBLDBFUKL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.75 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|