C9H12Cl2N2O — CID 47000809
4-amino-2-chloro-N-ethylbenzamide;hydrochloride (PubChem CID 47000809) has the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. Its IUPAC name is 4-amino-2-chloro-N-ethylbenzamide;hydrochloride.
| Compound Name | 4-amino-2-chloro-N-ethylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 47000809 |
| Molecular Formula | C9H12Cl2N2O |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 4-amino-2-chloro-N-ethylbenzamide;hydrochloride |
| SMILES | CCNC(=O)c1ccc(N)cc1Cl.Cl |
| InChI | InChI=1S/C9H11ClN2O.ClH/c1-2-12-9(13)7-4-3-6(11)5-8(7)10;/h3-5H,2,11H2,1H3,(H,12,13);1H |
| InChIKey | KNYDHBOIDIGZCT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|