C12H20Cl3N3O — CID 119861815
4-amino-2-chloro-N-[2-(dimethylamino)propyl]benzamide;dihydrochloride (PubChem CID 119861815) has the molecular formula C12H20Cl3N3O and a molecular weight of 328.67 g/mol. Its IUPAC name is 4-amino-2-chloro-N-[2-(dimethylamino)propyl]benzamide;dihydrochloride.
| Compound Name | 4-amino-2-chloro-N-[2-(dimethylamino)propyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119861815 |
| Molecular Formula | C12H20Cl3N3O |
| Molecular Weight | 328.67 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 4-amino-2-chloro-N-[2-(dimethylamino)propyl]benzamide;dihydrochloride |
| SMILES | CC(CNC(=O)c1ccc(N)cc1Cl)N(C)C.Cl.Cl |
| InChI | InChI=1S/C12H18ClN3O.2ClH/c1-8(16(2)3)7-15-12(17)10-5-4-9(14)6-11(10)13;;/h4-6,8H,7,14H2,1-3H3,(H,15,17);2*1H |
| InChIKey | VQCYSIKXAMPPBY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.67 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|