C12H17Cl2N3O — CID 61140669
3-amino-4,5-dichloro-N-[2-(dimethylamino)propyl]benzamide (PubChem CID 61140669) has the molecular formula C12H17Cl2N3O and a molecular weight of 290.19 g/mol. Its IUPAC name is 3-amino-4,5-dichloro-N-[2-(dimethylamino)propyl]benzamide.
| Compound Name | 3-amino-4,5-dichloro-N-[2-(dimethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 61140669 |
| Molecular Formula | C12H17Cl2N3O |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 3-amino-4,5-dichloro-N-[2-(dimethylamino)propyl]benzamide |
| SMILES | CC(CNC(=O)c1cc(N)c(Cl)c(Cl)c1)N(C)C |
| InChI | InChI=1S/C12H17Cl2N3O/c1-7(17(2)3)6-16-12(18)8-4-9(13)11(14)10(15)5-8/h4-5,7H,6,15H2,1-3H3,(H,16,18) |
| InChIKey | KHDNHUQCKUCERF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|