2-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]butanoic acid

C12H14Cl2N2O3 — CID 82833378

IUPAC2-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]butanoic acid
SMILESCCC(CNC(=O)c1cc(Cl)c(N)c(Cl)c1)C(=O)O
InChIInChI=1S/C12H14Cl2N2O3/c1-2-6(12(18)19)5-16-11(17)7-3-8(13)10(15)9(14)4-7/h3-4,6H,2,5,15H2,1H3,(H,16,17)(H,18,19)
InChIKeyNRIOKGMYWCIQSL-UHFFFAOYSA-N
MW305.16 g/mol
LogP2.42
Rot. Bonds5

About 2-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]butanoic acid

2-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]butanoic acid (PubChem CID 82833378) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is 2-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]butanoic acid.

Molecular Properties

Compound Name2-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]butanoic acid
PubChem CID82833378
Molecular FormulaC12H14Cl2N2O3
Molecular Weight305.16 g/mol
Exact Mass304.04
IUPAC Name2-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]butanoic acid
SMILESCCC(CNC(=O)c1cc(Cl)c(N)c(Cl)c1)C(=O)O
InChIInChI=1S/C12H14Cl2N2O3/c1-2-6(12(18)19)5-16-11(17)7-3-8(13)10(15)9(14)4-7/h3-4,6H,2,5,15H2,1H3,(H,16,17)(H,18,19)
InChIKeyNRIOKGMYWCIQSL-UHFFFAOYSA-N
XLogP2.42
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.16
LogP ≤ 52.42
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]butanoic acid?
The IUPAC name of 2-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]butanoic acid (CID 82833378) is 2-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]butanoic acid.
What is the SMILES notation for 2-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]butanoic acid?
The canonical SMILES for 2-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]butanoic acid is CCC(CNC(=O)c1cc(Cl)c(N)c(Cl)c1)C(=O)O.
What is the InChIKey of 2-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]butanoic acid?
The InChIKey is NRIOKGMYWCIQSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl2N2O3/c1-2-6(12(18)19)5-16-11(17)7-3-8(13)10(15)9(14)4-7/h3-4,6H,2,5,15H2,1H3,(H,16,17)(H,18,19).
What are the key properties of 2-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]butanoic acid?
2-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]butanoic acid has a molecular weight of 305.16 g/mol, XLogP of 2.42, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]butanoic acid is sourced from PubChem (CID 82833378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).