C11H11Cl2N3O — CID 82833436
4-amino-3,5-dichloro-N-(2-cyanopropyl)benzamide (PubChem CID 82833436) has the molecular formula C11H11Cl2N3O and a molecular weight of 272.14 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-(2-cyanopropyl)benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-(2-cyanopropyl)benzamide |
|---|---|
| PubChem CID | 82833436 |
| Molecular Formula | C11H11Cl2N3O |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 4-amino-3,5-dichloro-N-(2-cyanopropyl)benzamide |
| SMILES | CC(C#N)CNC(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2N3O/c1-6(4-14)5-16-11(17)7-2-8(12)10(15)9(13)3-7/h2-3,6H,5,15H2,1H3,(H,16,17) |
| InChIKey | UNKRWVKJYPLTIM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|