C11H14Cl2N2O2 — CID 82832737
4-amino-3,5-dichloro-N-(3-hydroxybutyl)benzamide (PubChem CID 82832737) has the molecular formula C11H14Cl2N2O2 and a molecular weight of 277.15 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-(3-hydroxybutyl)benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-(3-hydroxybutyl)benzamide |
|---|---|
| PubChem CID | 82832737 |
| Molecular Formula | C11H14Cl2N2O2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 4-amino-3,5-dichloro-N-(3-hydroxybutyl)benzamide |
| SMILES | CC(O)CCNC(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2O2/c1-6(16)2-3-15-11(17)7-4-8(12)10(14)9(13)5-7/h4-6,16H,2-3,14H2,1H3,(H,15,17) |
| InChIKey | YVRWNKZAPGRYHF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|