C14H20Cl2N2O — CID 63843419
3-amino-4,5-dichloro-N-(3-ethylpentan-2-yl)benzamide (PubChem CID 63843419) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is 3-amino-4,5-dichloro-N-(3-ethylpentan-2-yl)benzamide.
| Compound Name | 3-amino-4,5-dichloro-N-(3-ethylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 63843419 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 3-amino-4,5-dichloro-N-(3-ethylpentan-2-yl)benzamide |
| SMILES | CCC(CC)C(C)NC(=O)c1cc(N)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H20Cl2N2O/c1-4-9(5-2)8(3)18-14(19)10-6-11(15)13(16)12(17)7-10/h6-9H,4-5,17H2,1-3H3,(H,18,19) |
| InChIKey | DULOMPRREBDZHF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|