C13H19Cl2N3O2 — CID 62845335
3-amino-4,5-dichloro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzamide (PubChem CID 62845335) has the molecular formula C13H19Cl2N3O2 and a molecular weight of 320.22 g/mol. Its IUPAC name is 3-amino-4,5-dichloro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzamide.
| Compound Name | 3-amino-4,5-dichloro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 62845335 |
| Molecular Formula | C13H19Cl2N3O2 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 3-amino-4,5-dichloro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzamide |
| SMILES | COCCN(C)CCNC(=O)c1cc(N)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H19Cl2N3O2/c1-18(5-6-20-2)4-3-17-13(19)9-7-10(14)12(15)11(16)8-9/h7-8H,3-6,16H2,1-2H3,(H,17,19) |
| InChIKey | SDTCEZXBZHABDP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|