C14H19Cl2N3O2 — CID 61116726
3-amino-4,5-dichloro-N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide (PubChem CID 61116726) has the molecular formula C14H19Cl2N3O2 and a molecular weight of 332.23 g/mol. Its IUPAC name is 3-amino-4,5-dichloro-N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide.
| Compound Name | 3-amino-4,5-dichloro-N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 61116726 |
| Molecular Formula | C14H19Cl2N3O2 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 3-amino-4,5-dichloro-N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
| SMILES | CCN(CC(=O)NC(C)C)C(=O)c1cc(N)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H19Cl2N3O2/c1-4-19(7-12(20)18-8(2)3)14(21)9-5-10(15)13(16)11(17)6-9/h5-6,8H,4,7,17H2,1-3H3,(H,18,20) |
| InChIKey | GAFYNUQHHWAEFJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|