C11H12Cl3NO — CID 50849492
3,4,5-trichloro-N,N-diethylbenzamide (PubChem CID 50849492) has the molecular formula C11H12Cl3NO and a molecular weight of 280.58 g/mol. Its IUPAC name is 3,4,5-trichloro-N,N-diethylbenzamide.
| Compound Name | 3,4,5-trichloro-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 50849492 |
| Molecular Formula | C11H12Cl3NO |
| Molecular Weight | 280.58 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 3,4,5-trichloro-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl3NO/c1-3-15(4-2)11(16)7-5-8(12)10(14)9(13)6-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | WTXMCQDHWXNSHU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|