C13H15Cl2NO4 — CID 61383603
methyl 2-[(3,5-dichloro-4-methoxybenzoyl)-ethylamino]acetate (PubChem CID 61383603) has the molecular formula C13H15Cl2NO4 and a molecular weight of 320.17 g/mol. Its IUPAC name is methyl 2-[(3,5-dichloro-4-methoxybenzoyl)-ethylamino]acetate.
| Compound Name | methyl 2-[(3,5-dichloro-4-methoxybenzoyl)-ethylamino]acetate |
|---|---|
| PubChem CID | 61383603 |
| Molecular Formula | C13H15Cl2NO4 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | methyl 2-[(3,5-dichloro-4-methoxybenzoyl)-ethylamino]acetate |
| SMILES | CCN(CC(=O)OC)C(=O)c1cc(Cl)c(OC)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2NO4/c1-4-16(7-11(17)19-2)13(18)8-5-9(14)12(20-3)10(15)6-8/h5-6H,4,7H2,1-3H3 |
| InChIKey | HVDSDNKXMCJUOV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |