C18H19Cl2NO2 — CID 10736703
3,5-dichloro-N,N-diethyl-4-[hydroxy(phenyl)methyl]benzamide (PubChem CID 10736703) has the molecular formula C18H19Cl2NO2 and a molecular weight of 352.26 g/mol. Its IUPAC name is 3,5-dichloro-N,N-diethyl-4-[hydroxy(phenyl)methyl]benzamide.
| Compound Name | 3,5-dichloro-N,N-diethyl-4-[hydroxy(phenyl)methyl]benzamide |
|---|---|
| PubChem CID | 10736703 |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 3,5-dichloro-N,N-diethyl-4-[hydroxy(phenyl)methyl]benzamide |
| SMILES | CCN(CC)C(=O)c1cc(Cl)c(C(O)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C18H19Cl2NO2/c1-3-21(4-2)18(23)13-10-14(19)16(15(20)11-13)17(22)12-8-6-5-7-9-12/h5-11,17,22H,3-4H2,1-2H3 |
| InChIKey | JYNZFFMIUXRXKL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |