C18H21NO2 — CID 129385502
N,N-diethyl-2-[(S)-hydroxy(phenyl)methyl]benzamide (PubChem CID 129385502) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is N,N-diethyl-2-[(S)-hydroxy(phenyl)methyl]benzamide.
| Compound Name | N,N-diethyl-2-[(S)-hydroxy(phenyl)methyl]benzamide |
|---|---|
| PubChem CID | 129385502 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N,N-diethyl-2-[(S)-hydroxy(phenyl)methyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccccc1[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H21NO2/c1-3-19(4-2)18(21)16-13-9-8-12-15(16)17(20)14-10-6-5-7-11-14/h5-13,17,20H,3-4H2,1-2H3/t17-/m0/s1 |
| InChIKey | XKUSIMQTVIHZIK-KRWDZBQOSA-N |
| XLogP | 3.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |